RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1476 |
| Common Name | alpha-D-Galactosyl-(1->3)-1D-myo-inositol |
| Synonyms Names | O-alpha-D-Galactosyl-(1->3)-1D-myo-inositol ;3-O-alpha-D-Galactosyl-1D-myo-inositol ;1-alpha-D-Galactosyl-myo-inositol ;Galactinol |
| Formula | C12H22O11 |
| Formula at pH 7.2 (Predicted) | C12H22O11 |
| Molecular Weight | 342.296 |
| Structure |  |
| SMILES | C1(OC(CO)C(O)C(O)C(O)1)OC2(C(O)C(O)C(O)C(O)C(O)2) |
| Reactions | OSR0746 OSR1218 OSR1226 OSR1228 OSR1233 OSR1490 OSR1717 OSR2117 OSR2508 |
| Pathways | |
|---|---|
| KEGG | rn00052 |
| Metacyc | PWY-5338 PWY-5337 |
| Database Links | |
|---|---|
| Gramene | CPD-458 |
| KEGG | C01235 |
| ChEBI | 17505 |
| Pubchem Compound | 11727586 |
| Pubchem Substance | 4456 |