RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1478 |
| Common Name | Epimelibiose |
| Synonyms Names | 6-O-(alpha-D-Galactopyranosyl)-D-mannopyranose |
| Formula | C12H22O11 |
| Formula at pH 7.2 (Predicted) | C12H22O11 |
| Molecular Weight | 342.296 |
| Structure |  |
| SMILES | OCC1OC(OCC2OC(O)C(C(C2O)O)O)C(C(C1O)O)O |
| Reactions | OSR0748 |
| Pathways | |
|---|---|
| KEGG | rn00052 |
| Database Links | |
|---|---|
| KEGG | C05400 |
| ChEBI | 4808 |
| Pubchem Compound | 46173743 |
| Pubchem Substance | 7767 |