RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1479 |
| Common Name | Maltose |
| Synonyms Names | Malt sugar ;alpha-D-Glucopyranosyl-(1->4)-D-glucopyranose |
| Formula | C12H22O11 |
| Formula at pH 7.2 (Predicted) | C12H22O11 |
| Molecular Weight | 342.296 |
| Structure |  |
| SMILES | OCC1OC(OC2C(O)C(O)C(O)OC2CO)C(O)C(O)C1O |
| Reactions | OSR0544 OSR0711 OSR0714 OSR0943 OSR1088 OSR1152 OSR1165 OSR1368 OSR1750 OSR1760 OSR2121 OSR2244 OSR2245 OSR2309 OSR2317 OSR2379 OSR2611 |
| Pathways | |
|---|---|
| KEGG | rn00500 rn01100 rn00052 |
| Metacyc | PWY-842 GLYCOCAT-PWY PWY-2661 |
| Database Links | |
|---|---|
| KEGG | C00208 |
| ChEBI | 17306 |