RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1490 |
| Common Name | Propionyladenylate |
| Synonyms Names | Propionyl-adenosine monophosphate |
| Formula | C13H18N5O8P |
| Formula at pH 7.2 (Predicted) | C13H17N5O8P- |
| Molecular Weight | 403.284 |
| Structure |  |
| SMILES | CCC(=O)OP(=O)(OCC1OC(C(C1O)O)n1cnc2c1ncnc2N)O |
| Reactions | OSR0975 OSR2388 |
| Pathways | |
|---|---|
| KEGG | rn00640 rn01100 |
| Database Links | |
|---|---|
| KEGG | C05983 |
| Pubchem Compound | 440863 |
| Pubchem Substance | 8261 |