RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1495 |
| Common Name | Pantetheine 4'-phosphate |
| Synonyms Names | 4'-Phosphopantetheine ;Phosphopantetheine ;D-Pantetheine 4'-phosphate |
| Formula | C11H23N2O7PS |
| Formula at pH 7.2 (Predicted) | C11H21N2O7PS2- |
| Molecular Weight | 358.348 |
| Structure |  |
| SMILES | CC(C)(COP(O)(=O)O)C(O)C(=O)NCCC(=O)NCCS |
| Reactions | OSR0747 OSR1545 OSR1689 |
| Pathways | |
|---|---|
| KEGG | rn00770 rn01100 |
| Metacyc | COA-PWY |
| Database Links | |
|---|---|
| KEGG | C01134 |
| ChEBI | 16858 |