RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1496 |
| Common Name | S-(2,2-Dichloro-1-hydroxy)ethyl glutathione |
| Formula | C12H19Cl2N3O7S |
| Formula at pH 7.2 (Predicted) | C12H18Cl2N3O7S- |
| Molecular Weight | 420.266 |
| Structure |  |
| SMILES | O=C(NC(C(=O)NCC(=O)O)CSC(C(Cl)Cl)O)CCC(C(=O)O)N |
| Reactions | OSR0704 |
| Pathways | |
|---|---|
| KEGG | rn00980 |
| Database Links | |
|---|---|
| KEGG | C14861 |
| Pubchem Compound | 11954070 |
| Pubchem Substance | 17395859 |