RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1497 |
| Common Name | Thiamin diphosphate |
| Synonyms Names | Thiamine diphosphate ;Thiamin pyrophosphate ;TPP ;ThPP |
| Formula | C12H19N4O7P2S |
| Formula at pH 7.2 (Predicted) | C12H17N4O7P2S- |
| Molecular Weight | 425.314 |
| Structure |  |
| SMILES | C(c1(c(N)nc(C)nc1))[n+1]2(c(C)c(sc2)CCOP(O)(=O)OP(O)(=O)O) |
| Reactions | OSR0839 OSR0932 OSR1017 OSR1019 OSR1021 OSR1029 OSR1033 OSR1050 OSR1058 OSR1085 OSR1375 OSR1449 OSR1478 OSR1494 OSR1501 OSR1556 OSR1559 OSR1563 OSR1684 |
| Pathways | |
|---|---|
| KEGG | rn00010 rn01100 rn00020 rn00620 rn00650 rn01110 rn01120 rn00280 rn00730 |
| Metacyc | MENAQUINONESYN-PWY |
| Database Links | |
|---|---|
| KEGG | C00068 |
| ChEBI | 9532 |