RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1509 |
| Common Name | ITP |
| Synonyms Names | Inosine 5'-triphosphate ;Inosine triphosphate ;Inosine tripolyphosphate |
| Formula | C10H15N4O14P3 |
| Formula at pH 7.2 (Predicted) | C10H11N4O14P34- |
| Molecular Weight | 508.166 |
| Structure |  |
| SMILES | OC1C(COP(=O)(OP(=O)(OP(=O)(O)O)O)O)OC(C1O)n1cnc2c1[nH]cnc2=O |
| Reactions | OSR0763 OSR0775 OSR1293 OSR1302 OSR1314 OSR1578 OSR2535 |
| Pathways | |
|---|---|
| KEGG | rn00230 rn00052 rn01100 rn00240 rn00020 rn01110 rn01120 |
| Database Links | |
|---|---|
| KEGG | C00081 |
| ChEBI | 16039 |
| Pubchem Compound | 8583 |
| Pubchem Substance | 3381 |