RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1511 |
| Common Name | dTTP |
| Synonyms Names | Deoxythymidine triphosphate ;Deoxythymidine 5'-triphosphate ;TTP |
| Formula | C10H17N2O14P3 |
| Formula at pH 7.2 (Predicted) | C10H14N2O14P33- |
| Molecular Weight | 482.168 |
| Structure |  |
| SMILES | CC1=CN(C2CC(O)C(CO[P](O)(=O)O[P](O)(=O)O[P](O)(O)=O)O2)C(=O)NC1=O |
| Reactions | OSR0762 OSR1284 OSR1292 OSR1328 OSR1564 OSR1582 |
| Pathways | |
|---|---|
| KEGG | rn00240 rn01100 rn00230 |
| Metacyc | DTDPRHAMSYN-PWY PWY0-166 |
| Database Links | |
|---|---|
| KEGG | C00459 |
| ChEBI | 18077 |