RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1513 |
| Common Name | (R)-S-Lactoylglutathione |
| Synonyms Names | S-D-Lactoylglutathione |
| Formula | C13H21N3O8S |
| Formula at pH 7.2 (Predicted) | C13H20N3O8S- |
| Molecular Weight | 379.386 |
| Structure |  |
| SMILES | C(O)(=O)C(N)CCC(=O)NC(CSC(=O)C(C)O)C(=O)NCC(=O)O |
| Reactions | OSR0725 OSR0769 OSR1246 |
| Pathways | |
|---|---|
| KEGG | rn00620 |
| Metacyc | PWY-5386 |
| Database Links | |
|---|---|
| KEGG | C03451 |
| ChEBI | 15694 |