RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1516 |
| Common Name | 6-Mercaptopurine ribonucleoside triphosphate |
| Synonyms Names | 6-Thioinosine-5'-triphosphate |
| Formula | C10H15N4O13P3S |
| Formula at pH 7.2 (Predicted) | C10H12N4O13P3S3- |
| Molecular Weight | 524.231 |
| Structure |  |
| SMILES | OC1C(COP(=O)(OP(=O)(OP(=O)(O)O)O)O)OC(C1O)n1cnc2c1[nH]cnc2=S |
| Reactions | OSR0770 |
| Pathways | |
|---|---|
| KEGG | rn00983 |
| Database Links | |
|---|---|
| KEGG | C16617 |
| Pubchem Compound | 3036942 |
| Pubchem Substance | 51090943 |