RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1517 |
| Common Name | 3'-Phosphoadenylyl sulfate |
| Synonyms Names | 3'-Phosphoadenosine 5'-phosphosulfate ;3'-Phospho-5'-adenylyl sulfate ;PAPS ;adenosine 3'-phosphate 5'-phosphosulfate |
| Formula | C10H15N5O13P2S |
| Formula at pH 7.2 (Predicted) | C10H11N5O13P2S4- |
| Molecular Weight | 507.264 |
| Structure |  |
| SMILES | [CH]1(O[CH](C(C(O)1)OP(=O)(O)O)COP(O)(=O)OS(O)(=O)=O)n2(c3(c(nc2)c(N)ncn3)) |
| Reactions | OSR0765 OSR1357 OSR1601 OSR2489 OSR2564 |
| Pathways | |
|---|---|
| KEGG | rn00920 rn01100 rn01120 rn00230 |
| Metacyc | SO4ASSIM-PWY |
| Database Links | |
|---|---|
| KEGG | C00053 |
| ChEBI | 17980 |