RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1518 |
| Common Name | Melibiitol |
| Synonyms Names | 6-O-alpha-D-Galactosyl-D-glucitol |
| Formula | C12H24O11 |
| Formula at pH 7.2 (Predicted) | C12H24O11 |
| Molecular Weight | 344.312 |
| Structure |  |
| SMILES | OCC(C(C(C(COC1OC(CO)C(C(C1O)O)O)O)O)O)O |
| Reactions | OSR0798 |
| Pathways | |
|---|---|
| KEGG | rn00052 |
| Database Links | |
|---|---|
| KEGG | C05399 |
| ChEBI | 27527 |
| Pubchem Compound | 15559964 |
| Pubchem Substance | 7766 |