RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1530 |
| Common Name | XTP |
| Synonyms Names | Xanthosine 5'-triphosphate |
| Formula | C10H15N4O15P3 |
| Formula at pH 7.2 (Predicted) | C10H12N4O15P33- |
| Molecular Weight | 524.165 |
| Structure |  |
| SMILES | O=c1[nH]c(=O)c2c([nH]1)n(cn2)C1OC(C(C1O)O)COP(=O)(OP(=O)(OP(=O)(O)O)O)O |
| Reactions | OSR0784 |
| Pathways | |
|---|---|
| KEGG | rn00230 |
| Database Links | |
|---|---|
| KEGG | C00700 |
| Pubchem Compound | 439296 |
| Pubchem Substance | 3968 |