RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1536 |
| Common Name | Se-Adenosyl-L-selenohomocysteine |
| Synonyms Names | Se-Adenosylselenohomocysteine |
| Formula | C14H20N6O5Se |
| Formula at pH 7.2 (Predicted) | C14H20N6O5Se |
| Molecular Weight | 431.306 |
| Structure |  |
| SMILES | OC(=O)C(CC[Se]CC1OC(C(C1O)O)n1cnc2c1ncnc2N)N |
| Reactions | OSR0799 OSR0851 |
| Database Links | |
|---|---|
| KEGG | C05692 |
| Pubchem Compound | 49787002 |
| Pubchem Substance | 7999 |