RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1542 |
| Common Name | 3'-Phosphoadenylylselenate |
| Synonyms Names | 3'-Phosphoadenosine-5'-phosphoselenate |
| Formula | C10H15N5O13P2Se |
| Formula at pH 7.2 (Predicted) | C10H12N5O13P2Se3- |
| Molecular Weight | 554.159 |
| Structure |  |
| SMILES | OC1C(OP(=O)(O)O)C(OC1n1cnc2c1ncnc2N)COP(=O)(O[Se](=O)(=O)O)O |
| Reactions | OSR1589 |
| Database Links | |
|---|---|
| KEGG | C05696 |
| Pubchem Compound | 24892762 |
| Pubchem Substance | 8003 |