RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1543 |
| Common Name | 5'-(4-fluorosulfonylbenzoyl)adenosine |
| Formula | C17H16FN5O7S |
| Formula at pH 7.2 (Predicted) | C17H16FN5O7S |
| Structure |  |
| SMILES | FS(=O)(=O)c1ccc(cc1)C(=O)C(O)[C@H]4O[C@@H](n3cnc2c(N)ncnc23)[C@H](O)[C@@H]4O |
| Reactions | OSR1462 |
| Pathways | |
|---|---|
| KEGG | rn00270 rn01100 |
| Metacyc | PWY-4361 PWY0-1391 |