RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1553 |
| Common Name | Gibberellin A51 |
| Formula | C19H24O5 |
| Formula at pH 7.2 (Predicted) | C19H23O5- |
| Molecular Weight | 332.391 |
| Structure |  |
| SMILES | C=C1(C2(CC5(C1)([CH](CC2)C34(OC(=O)C(CC(O)C3)(C)[CH]4C5C(=O)O)))) |
| Reactions | OSR1068 OSR1093 |
| Pathways | |
|---|---|
| KEGG | rn00904 |
| Database Links | |
|---|---|
| Gramene | CPD-482 |
| KEGG | C11865 |
| ChEBI | 29599 |
| Pubchem Compound | 443458 |
| Pubchem Substance | 14027 |