RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1561 |
| Common Name | CDP-ethanolamine |
| Synonyms Names | Cytidine diphosphate ethanolamine |
| Formula | C11H20N4O11P2 |
| Formula at pH 7.2 (Predicted) | C11H19N4O11P2- |
| Molecular Weight | 446.244 |
| Structure |  |
| SMILES | NCCO[P](O)(=O)O[P](O)(=O)OCC1OC(C(O)C1O)N2C=CC(=NC2=O)N |
| Reactions | OSR1022 OSR1056 OSR1104 OSR1107 OSR1142 |
| Pathways | |
|---|---|
| KEGG | rn00564 rn01100 rn00565 |
| Metacyc | PHOSLIPSYN2-PWY |
| Database Links | |
|---|---|
| KEGG | C00570 |
| ChEBI | 16732 |