RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1562 |
| Common Name | (R)-4'-Phosphopantothenoyl-L-cysteine |
| Synonyms Names | N-[(R)-4'-Phosphopantothenoyl]-L-cysteine |
| Formula | C12H23N2O9PS |
| Formula at pH 7.2 (Predicted) | C12H20N2O9PS3- |
| Molecular Weight | 402.358 |
| Structure |  |
| SMILES | CC(C)(COP(O)(O)=O)C(O)C(=O)NCCC(=O)NC(C(O)=O)CS |
| Reactions | OSR0747 OSR1628 OSR1796 OSR1833 |
| Pathways | |
|---|---|
| KEGG | rn00770 rn01100 |
| Metacyc | COA-PWY |
| Database Links | |
|---|---|
| KEGG | C04352 |
| ChEBI | 15769 |