RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1569 |
| Common Name | Gibberellin A1 |
| Synonyms Names | Gibberellin 1 |
| Formula | C19H24O6 |
| Formula at pH 7.2 (Predicted) | C19H23O6- |
| Molecular Weight | 348.39 |
| Structure |  |
| SMILES | C=C1(C2(CC5(C1)([CH](CC2)C34(OC(=O)C(C(O)CC3)(C)[CH]4C5C(=O)O)))(O)) |
| Reactions | OSR1099 OSR1114 |
| Pathways | |
|---|---|
| KEGG | rn01110 rn00904 rn01100 |
| Metacyc | PWY-5035 PWY-102 |
| Database Links | |
|---|---|
| KEGG | C00859 |
| ChEBI | 27717 |
| Pubchem Compound | 439329 |
| Pubchem Substance | 4116 |