RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1570 |
| Common Name | Gibberellin A29 |
| Synonyms Names | gibberellin 29 |
| Formula | C19H24O6 |
| Formula at pH 7.2 (Predicted) | C19H23O6- |
| Molecular Weight | 348.39 |
| Structure |  |
| SMILES | C=C1(C2(CC5(C1)([CH](CC2)C34(OC(=O)C(CC(O)C3)(C)[CH]4C5C(=O)O)))(O)) |
| Reactions | OSR1100 OSR1110 |
| Pathways | |
|---|---|
| KEGG | rn00904 |
| Metacyc | PWY-102 |
| Database Links | |
|---|---|
| Gramene | CPD-236 |
| KEGG | C06096 |
| ChEBI | 28040 |
| Pubchem Compound | 14605548 |
| Pubchem Substance | 8362 |