RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1574 |
| Common Name | Retinal |
| Synonyms Names | Vitamin A aldehyde ;Retinene ;all-trans-Retinal ;all-trans-Vitamin A aldehyde ;all-trans-Retinene |
| Formula | C20H28O |
| Formula at pH 7.2 (Predicted) | C20H28O |
| Molecular Weight | 284.436 |
| Structure |  |
| SMILES | O=CC=C(C=CC=C(C=CC1=C(C)CCCC1(C)C)C)C |
| Reactions | OSR2302 OSR2369 |
| Pathways | |
|---|---|
| KEGG | rn00830 rn01100 |
| Database Links | |
|---|---|
| KEGG | C00376 |
| ChEBI | 17898 |
| Pubchem Compound | 638015 |
| Pubchem Substance | 3666 |