RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1582 |
| Common Name | Phosphatidylinositol 4-phosphate |
| Synonyms Names | 1-phosphatidyl-1D-myo-inositol 4-phosphate ;C01277 ;1,2-Diacyl-sn-glycero-3-phospho-(1'-myo-inositol-4'-phosphate) ;1-phosphatidyl-1D-myo-inositol 4-phosphate |
| Formula | C11H18O16P2R2 |
| Formula at pH 7.2 (Predicted) | C11H15O16P2R25- |
| Structure |  |
| SMILES | OC1C(O)C(O[P](O)(=O)OCC(COC(=O)[R])OC(=O)[R])C(O)C(O)C1O[P](O)(O)=O |
| Reactions | OSR1662 OSR2554 |
| Pathways | |
|---|---|
| KEGG | rn00562 rn01100 |
| Metacyc | PWY-6352 PWY-6351 |
| Database Links | |
|---|---|
| Gramene | CPD-1108 |
| KEGG | C01277 |
| Pubchem Substance | 4496 |