RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1590 |
| Common Name | 2,5-Diaminopyrimidine nucleoside triphosphate |
| Formula | C9H18N5O14P3 |
| Formula at pH 7.2 (Predicted) | C9H14N5O14P34- |
| Molecular Weight | 513.186 |
| Structure |  |
| SMILES | OC1C(COP(=O)(OP(=O)(OP(=O)(O)O)O)O)OC(C1O)Nc1[nH]c(N)nc(=O)c1N |
| Reactions | OSR0761 OSR0915 |
| Pathways | |
|---|---|
| KEGG | rn00790 rn01100 |
| Database Links | |
|---|---|
| KEGG | C05923 |
| ChEBI | 929 |
| Pubchem Compound | 440841 |
| Pubchem Substance | 8211 |