RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1596 |
| Common Name | (9Z,12Z,15Z)-Octadecatrienoic acid |
| Synonyms Names | alpha-Linolenic acid ;9,12,15-Octadecatrienoic acid ;Linolenate ;alpha-Linolenate |
| Formula | C18H30O2 |
| Formula at pH 7.2 (Predicted) | C18H29O2- |
| Molecular Weight | 278.43 |
| Structure |  |
| SMILES | CCC=C/C/C=CCC=C/CCCCCCCC(O)=O |
| Reactions | OSR0836 OSR0842 OSR1091 OSR1317 |
| Pathways | |
|---|---|
| KEGG | rn00592 rn01100 |
| Metacyc | PWY-735 PWY-5410 |
| Database Links | |
|---|---|
| KEGG | C06427 |
| ChEBI | 27432 |