RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1598 |
| Common Name | momilactone B |
| Formula | C20H26O4 |
| Formula at pH 7.2 (Predicted) | C20H26O4 |
| Molecular Weight | 330.423 |
| Structure |  |
| SMILES | C=CC1(C)CCC2C(=CC3C4C52CCC(OC5)(C4(C(=O)O3)C)O)C1 |
| Reactions | OSR0779 |