RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1600 |
| Common Name | daidzein 7-O-beta-D-glucoside |
| Formula | C21H20O9 |
| Formula at pH 7.2 (Predicted) | C21H20O9 |
| Structure |  |
| SMILES | O=C3c4ccc(O[C@@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)CO)cc4O/C=C3/c2ccc(O)cc2 |
| Reactions | OSR1610 |
| Pathways | |
|---|---|
| KEGG | rn00943 |
| Metacyc | PWY-2861 PWY-2343 PWY-2904 PWY-2345 PWY-2701 PWY-2561 |