RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1604 |
| Common Name | O-beta-D-Glucopyranosyl-cis-zeatin |
| Synonyms Names | cis-Zeatin-O-glucoside |
| Formula | C16H23N5O6 |
| Formula at pH 7.2 (Predicted) | C16H23N5O6 |
| Molecular Weight | 381.384 |
| Structure |  |
| SMILES | c2(c1(c(N=CN1)ncn2))NCC=C(C)COC3(OC(CO)C(O)C(O)C(O)3) |
| Reactions | OSR1592 |
| Pathways | |
|---|---|
| KEGG | rn00908 |
| Metacyc | PWY-2902 |
| Database Links | |
|---|---|
| Gramene | CPD-4620 |
| KEGG | C15546 |
| Pubchem Compound | 5280589 |
| Pubchem Substance | 17396538 |