RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1613 |
| Common Name | Ubiquinone |
| Synonyms Names | Coenzyme Q ;CoQ ;Q |
| Formula | C14H18O4(C5H8)n |
| Formula at pH 7.2 (Predicted) | C19H26O4 |
| Structure |  |
| SMILES | COC1=C(OC)C(=O)C(=C(C)C1=O)CC=C(C)CCC=C(C)C |
| Reactions | OSR1771 OSR2199 OSR2304 OSR2769 |
| Pathways | |
|---|---|
| KEGG | rn00130 rn01100 rn01110 rn00020 |
| Database Links | |
|---|---|
| KEGG | C00399 |
| ChEBI | 16389 |