RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1614 |
| Common Name | N6-(delta2-Isopentenyl)-adenosine 5'-monophosphate |
| Synonyms Names | N6-(Dimethylallyl)adenosine 5'-phosphate ;Isopentenyl-AMP |
| Formula | C15H22N5O7P |
| Formula at pH 7.2 (Predicted) | C15H20N5O7P2- |
| Molecular Weight | 415.338 |
| Structure |  |
| SMILES | C1(C(O)C(O)C(O1)COP(O)(O)=O)n2(c3(c(nc2)c(ncn3)NCC=C(C)C)) |
| Reactions | OSR0884 OSR0889 OSR0987 OSR1042 OSR2394 OSR2666 |
| Pathways | |
|---|---|
| KEGG | rn00908 |
| Metacyc | PWY-2681 |
| Database Links | |
|---|---|
| Gramene | CPD-4205 |
| KEGG | C04713 |
| ChEBI | 15819 |
| Pubchem Compound | 100221 |
| Pubchem Substance | 7285 |