RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1615 |
| Common Name | Thiamin triphosphate |
| Synonyms Names | Thiamine triphosphate |
| Formula | C12H20N4O10P3S |
| Formula at pH 7.2 (Predicted) | C12H17N4O10P3S2- |
| Molecular Weight | 505.294 |
| Structure |  |
| SMILES | Cc1ncc(c(n1)N)C[n+]1csc(c1C)CCOP(=O)(OP(=O)(OP(=O)(O)O)O)O |
| Reactions | OSR1684 |
| Pathways | |
|---|---|
| KEGG | rn00730 rn01100 |
| Database Links | |
|---|---|
| KEGG | C03028 |
| ChEBI | 9534 |
| Pubchem Compound | 511 |
| Pubchem Substance | 5933 |