RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1617 |
| Common Name | 2,3-Dihydro-2-S-glutathionyl-3-hydroxy bromobenzene |
| Formula | C16H22BrN3O7S |
| Molecular Weight | 480.331 |
| Structure |  |
| SMILES | O=C(NC(C(=O)NCC(=O)O)CSC1C(O)C=CC=C1Br)CCC(C(=O)O)N |
| Reactions | OSR0791 |
| Pathways | |
|---|---|
| KEGG | rn00980 |
| Database Links | |
|---|---|
| KEGG | C14848 |
| Pubchem Compound | 11954067 |
| Pubchem Substance | 17395846 |