RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1625 |
| Common Name | Gibberellin A24 |
| Formula | C20H26O5 |
| Formula at pH 7.2 (Predicted) | C20H24O52- |
| Molecular Weight | 346.417 |
| Structure |  |
| SMILES | CC1([CH]4(C(CCC1)(C=O)[CH]3(C2(CC(C(=C)C2)CC3)(C4C(=O)O))))(C(=O)O) |
| Reactions | OSR0807 OSR1102 OSR1150 OSR1155 OSR1197 |
| Pathways | |
|---|---|
| KEGG | rn00904 rn01100 rn01110 |
| Metacyc | PWY-5070 |
| Database Links | |
|---|---|
| KEGG | C11861 |
| Pubchem Compound | 443454 |
| Pubchem Substance | 14023 |