RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1631 |
| Common Name | 3-beta-hydroxy-9-beta-pimara-7,15-diene-19,6-beta-olide |
| Synonyms Names | 3beta-Hydroxy-9beta-pimara-7,15-diene-19,6beta-olide |
| Formula | C20H28O3 |
| Formula at pH 7.2 (Predicted) | C20H28O3 |
| Molecular Weight | 316.435 |
| Structure |  |
| SMILES | CC1(CC3([CH](CC1)C2([CH]4(C(C)(C(O)CC2)C(=O)O[CH](C=3)4))(C)))(C=C) |
| Reactions | OSR0787 OSR0825 OSR2300 OSR2377 |
| Pathways | |
|---|---|
| KEGG | rn00904 rn01110 |
| Metacyc | PWY4KF-48 |
| Database Links | |
|---|---|
| KEGG | C18016 |
| Pubchem Compound | 21596475 |
| Pubchem Substance | 96024236 |