RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1632 |
| Common Name | Gibberellin A12 aldehyde |
| Formula | C20H28O3 |
| Formula at pH 7.2 (Predicted) | C20H27O3- |
| Molecular Weight | 316.435 |
| Structure |  |
| SMILES | CC1([CH]4(C(CCC1)(C)[CH]3(C2(CC(C(=C)C2)CC3)(C4C=O))))(C(=O)O) |
| Reactions | OSR2418 OSR2437 |
| Pathways | |
|---|---|
| KEGG | rn00904 rn01100 rn01110 |
| Metacyc | PWY-5034 PWY-5047 |
| Database Links | |
|---|---|
| KEGG | C06093 |
| ChEBI | 15610 |
| Pubchem Compound | 440913 |
| Pubchem Substance | 8359 |