RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1635 |
| Common Name | Retinol |
| Synonyms Names | all-trans-Retinol ;Vitamin A ;Vitamin A1 |
| Formula | C20H30O |
| Formula at pH 7.2 (Predicted) | C20H30O |
| Molecular Weight | 286.452 |
| Structure |  |
| SMILES | OCC=C(C=CC=C(C=CC1=C(C)CCCC1(C)C)C)C |
| Reactions | OSR2302 OSR2369 OSR2482 OSR2881 |
| Pathways | |
|---|---|
| KEGG | rn00830 rn01100 |
| Database Links | |
|---|---|
| KEGG | C00473 |
| ChEBI | 17336 |
| Pubchem Compound | 445354 |
| Pubchem Substance | 3756 |