RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1638 |
| Common Name | Folate |
| Synonyms Names | Pteroylglutamic acid ;Folic acid |
| Formula | C19H19N7O6 |
| Formula at pH 7.2 (Predicted) | C19H17N7O62- |
| Molecular Weight | 441.397 |
| Structure |  |
| SMILES | OC(=O)CCC(C(=O)O)NC(=O)c1ccc(cc1)NCc1cnc2c(n1)c(=O)nc([nH]2)N |
| Reactions | OSR2325 OSR2332 OSR2396 OSR2413 |
| Pathways | |
|---|---|
| KEGG | rn00670 rn00790 rn01100 |
| Database Links | |
|---|---|
| KEGG | C00504 |
| ChEBI | 27470 |
| Pubchem Compound | 6037 |
| Pubchem Substance | 3787 |