RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1639 |
| Common Name | Formamidopyrimidine nucleoside triphosphate |
| Formula | C10H18N5O15P3 |
| Formula at pH 7.2 (Predicted) | C10H14N5O15P34- |
| Molecular Weight | 541.196 |
| Structure |  |
| SMILES | O=CNc1c(NC2OC(C(C2O)O)COP(=O)(OP(=O)(OP(=O)(O)O)O)O)[nH]c(nc1=O)N |
| Reactions | OSR0810 OSR0915 |
| Pathways | |
|---|---|
| KEGG | rn00790 rn01100 |
| Metacyc | FOLSYN-PWY PWY-3742 |
| Database Links | |
|---|---|
| KEGG | C05922 |
| Pubchem Compound | 440840 |
| Pubchem Substance | 8210 |