RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1642 |
| Common Name | Se-Adenosylselenomethionine |
| Formula | C15H23N6O5Se |
| Formula at pH 7.2 (Predicted) | C15H23N6O5Se+ |
| Molecular Weight | 446.34 |
| Structure |  |
| SMILES | C[Se+](CC1OC(C(C1O)O)n1cnc2c1ncnc2N)CCC(C(=O)O)N |
| Reactions | OSR0851 OSR1215 |
| Database Links | |
|---|---|
| KEGG | C05691 |
| Pubchem Compound | 49787001 |
| Pubchem Substance | 7998 |