RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1645 |
| Common Name | 9-beta-pimara-7,15-diene |
| Synonyms Names | 9beta-Pimara-7,15-diene |
| Formula | C20H32 |
| Formula at pH 7.2 (Predicted) | C20H32 |
| Molecular Weight | 272.468 |
| Structure |  |
| SMILES | CC1(C)CCCC2(C)C3CCC(C)(CC3=CCC12)C=C |
| Reactions | OSR0825 OSR0989 OSR1079 OSR1082 |
| Pathways | |
|---|---|
| KEGG | rn00904 rn01110 |
| Metacyc | PWY4KF-48 PWY-2981 |
| Database Links | |
|---|---|
| KEGG | C18225 |
| Pubchem Compound | 10355909 |
| Pubchem Substance | 103061407 |