RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1647 |
| Common Name | ent-Pimara-8(14),15-diene |
| Formula | C20H32 |
| Formula at pH 7.2 (Predicted) | C20H32 |
| Molecular Weight | 272.468 |
| Structure |  |
| SMILES | CC1(C)(C2(C(C)(CCC1)C3(C(CC2)=CC(CC3)(C)C=C))) |
| Reactions | OSR1065 |
| Pathways | |
|---|---|
| KEGG | rn00904 rn01110 |
| Metacyc | PWY-2981 |
| Database Links | |
|---|---|
| KEGG | C18228 |
| Pubchem Compound | 12314280 |
| Pubchem Substance | 103061410 |