RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1657 |
| Common Name | 9(S)-HPOT |
| Synonyms Names | (10E,12Z,15Z)-(9S)-9-Hydroperoxyoctadeca-10,12,15-trienoic acid ;9(S)-HpOTrE |
| Formula | C18H30O4 |
| Formula at pH 7.2 (Predicted) | C18H29O4- |
| Molecular Weight | 310.428 |
| Structure |  |
| SMILES | CCC=CCC=CC=CC(OO)CCCCCCCC(=O)O |
| Reactions | OSR0837 OSR0842 OSR0850 |
| Pathways | |
|---|---|
| KEGG | rn00592 |
| Database Links | |
|---|---|
| Gramene | CPD-8678 |
| KEGG | C16321 |
| Pubchem Compound | 6450029 |
| Pubchem Substance | 47205629 |