RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1659 |
| Common Name | Linoleate |
| Synonyms Names | Linoleic acid ;(9Z,12Z)-Octadecadienoic acid ;9-cis,12-cis-Octadecadienoate ;9-cis,12-cis-Octadecadienoic acid |
| Formula | C18H32O2 |
| Formula at pH 7.2 (Predicted) | C18H31O2- |
| Molecular Weight | 280.445 |
| Structure |  |
| SMILES | CCCCC/C=CCC=C/CCCCCCCC(O)=O |
| Reactions | OSR0905 OSR0940 OSR1119 OSR1339 OSR1978 |
| Pathways | |
|---|---|
| KEGG | rn00591 rn01100 rn00592 |
| Metacyc | PWY-5409 PWY-5410 PWY-735 |
| Database Links | |
|---|---|
| KEGG | C01595 |
| ChEBI | 17351 |