RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1662 |
| Common Name | Gibberellin A19 |
| Synonyms Names | Gibberellin 19 |
| Formula | C20H26O6 |
| Formula at pH 7.2 (Predicted) | C20H24O62- |
| Molecular Weight | 362.417 |
| Structure |  |
| SMILES | CC1([CH]4(C(CCC1)(C=O)[CH]3(C2(CC(C(=C)C2)(O)CC3)(C4C(=O)O))))(C(=O)O) |
| Reactions | OSR0826 OSR1128 OSR1183 OSR1236 |
| Pathways | |
|---|---|
| KEGG | rn00904 |
| Metacyc | PWY-5035 |
| Database Links | |
|---|---|
| KEGG | C02034 |
| ChEBI | 28731 |
| Pubchem Compound | 46173718 |
| Pubchem Substance | 5127 |