RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1665 |
| Common Name | Gibberellin A12 |
| Formula | C20H28O4 |
| Formula at pH 7.2 (Predicted) | C20H26O42- |
| Molecular Weight | 332.434 |
| Structure |  |
| SMILES | CC1([CH]4(C(CCC1)(C)[CH]3(C2(CC(C(=C)C2)CC3)(C4C(=O)O))))(C(=O)O) |
| Reactions | OSR0937 OSR1172 OSR1182 OSR1185 OSR2391 OSR2418 |
| Pathways | |
|---|---|
| KEGG | rn00904 rn01100 rn01110 |
| Metacyc | PWY-5070 PWY-5034 PWY-5047 |
| Database Links | |
|---|---|
| KEGG | C11857 |
| ChEBI | 30088 |
| Pubchem Compound | 443450 |
| Pubchem Substance | 14019 |