RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1671 |
| Common Name | Kaur-16-en-18-oic acid |
| Synonyms Names | (-)-Kaur-16-en-19-oic acid ;Kaurenic acid ;Kaurenoic acid ;ent-Kaur-16(17)-en-19-oic acid ;ent-Kaurenoic acid ;ent-Kaur-16-en-19-oic acid ;ent-Kaur-16-en-19-oate |
| Formula | C20H30O2 |
| Formula at pH 7.2 (Predicted) | C20H29O2- |
| Molecular Weight | 302.451 |
| Structure |  |
| SMILES | CC1([CH]2(C(CCC1)(C)[CH]4(C3(CC2)(CC(C(=C)C3)CC4))))(C(=O)O) |
| Reactions | OSR2422 OSR2440 OSR2446 |
| Pathways | |
|---|---|
| KEGG | rn00904 rn01100 rn01110 |
| Metacyc | PWY-5034 PWY-5047 |
| Database Links | |
|---|---|
| KEGG | C11874 |
| Pubchem Compound | 73062 |
| Pubchem Substance | 14036 |