RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1672 |
| Common Name | kaempferol 3-O-beta-D-glucoside |
| Synonyms Names | quercetin 3-O-beta-D-glucoside |
| Formula | C21H20O11; C21H19O12- |
| Formula at pH 7.2 (Predicted) | C21H19O11- |
| Structure |  |
| SMILES | O=C2C(O[C@@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)CO)=C(/Oc3cc(O)cc(O)c23)c4ccc(O)cc4; C1=CC(=C(C=C1C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)OC4C(C(C(C(O4)CO)O)O)O)O)[O-] |
| Reactions | OSR1663 OSR1679 |
| Pathways | |
|---|---|
| KEGG | rn01110 rn00944 rn01100 |
| Metacyc | PWY-6360 PWY-5320 PWY-5348 PWY-5321 |