RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1680 |
| Common Name | Monolysocardiolipin |
| Synonyms Names | MLCL ;C18129 |
| Formula | C12H19O16P2R3 |
| Formula at pH 7.2 (Predicted) | C12H17O16P2R3 |
| Structure |  |
| SMILES | OC(COC(=O)[R])CO[P](O)(=O)OCC(O)CO[P](O)(=O)OCC(COC(=O)[R])OC(=O)[R] |
| Reactions | OSR2488 |
| Pathways | |
|---|---|
| KEGG | rn00564 |
| Database Links | |
|---|---|
| KEGG | C18129 |
| Pubchem Substance | 96024346 |