RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1681 |
| Common Name | Ubiquinol |
| Synonyms Names | QH2 ;CoQH2 |
| Formula | C14H20O4(C5H8)n |
| Formula at pH 7.2 (Predicted) | C19H28O4 |
| Structure |  |
| SMILES | COC1=C(OC)C(=C(CC=C(C)CCC=C(C)C)C(=C1O)C)O |
| Reactions | OSR2199 OSR2304 OSR2769 |
| Pathways | |
|---|---|
| KEGG | rn00020 rn01100 rn01110 |
| Database Links | |
|---|---|
| KEGG | C00390 |
| ChEBI | 17976 |